C13H21F3N2O5 — CID 166999411
(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (PubChem CID 166999411) has the molecular formula C13H21F3N2O5 and a molecular weight of 342.31 g/mol. Its IUPAC name is (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid.
| Compound Name | (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 166999411 |
| Molecular Formula | C13H21F3N2O5 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C13H21F3N2O5/c1-12(2,3)23-11(22)17-7-5-4-6-8(9(19)20)18-10(21)13(14,15)16/h8H,4-7H2,1-3H3,(H,17,22)(H,18,21)(H,19,20)/t8-/m0/s1 |
| InChIKey | JPFUYRHHGNHAED-QMMMGPOBSA-N |
| XLogP | 1.81 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|