C19H25ClN2O4 — CID 19596743
tert-butyl N-[2-[[5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-yl]oxy]ethyl]carbamate (PubChem CID 19596743) has the molecular formula C19H25ClN2O4 and a molecular weight of 380.87 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-yl]oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-yl]oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 19596743 |
| Molecular Formula | C19H25ClN2O4 |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | tert-butyl N-[2-[[5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-yl]oxy]ethyl]carbamate |
| SMILES | CC(C)c1c(OCCNC(=O)OC(C)(C)C)noc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H25ClN2O4/c1-12(2)15-16(13-6-8-14(20)9-7-13)26-22-17(15)24-11-10-21-18(23)25-19(3,4)5/h6-9,12H,10-11H2,1-5H3,(H,21,23) |
| InChIKey | CHQGCFNDQYMUCJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|