C14H22ClNO3 — CID 145267915
tert-butyl N-(2-hydroxyethyl)carbamate;1-chloro-4-methylbenzene (PubChem CID 145267915) has the molecular formula C14H22ClNO3 and a molecular weight of 287.79 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxyethyl)carbamate;1-chloro-4-methylbenzene.
| Compound Name | tert-butyl N-(2-hydroxyethyl)carbamate;1-chloro-4-methylbenzene |
|---|---|
| PubChem CID | 145267915 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | tert-butyl N-(2-hydroxyethyl)carbamate;1-chloro-4-methylbenzene |
| SMILES | CC(C)(C)OC(=O)NCCO.Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H7Cl.C7H15NO3/c1-6-2-4-7(8)5-3-6;1-7(2,3)11-6(10)8-4-5-9/h2-5H,1H3;9H,4-5H2,1-3H3,(H,8,10) |
| InChIKey | BREBVHGHSCWPCX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |