C15H22ClNO3 — CID 153329637
tert-butyl N-[(3S)-3-(4-chlorophenyl)-3-methoxypropyl]carbamate (PubChem CID 153329637) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is tert-butyl N-[(3S)-3-(4-chlorophenyl)-3-methoxypropyl]carbamate.
| Compound Name | tert-butyl N-[(3S)-3-(4-chlorophenyl)-3-methoxypropyl]carbamate |
|---|---|
| PubChem CID | 153329637 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | tert-butyl N-[(3S)-3-(4-chlorophenyl)-3-methoxypropyl]carbamate |
| SMILES | CO[C@@H](CCNC(=O)OC(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H22ClNO3/c1-15(2,3)20-14(18)17-10-9-13(19-4)11-5-7-12(16)8-6-11/h5-8,13H,9-10H2,1-4H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | FTEGTNZHURJGRZ-ZDUSSCGKSA-N |
| XLogP | 3.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |