C17H27N3O4 — CID 95145487
tert-butyl N-[2-[[(2R)-2-methoxy-2-phenylethyl]carbamoylamino]ethyl]carbamate (PubChem CID 95145487) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2R)-2-methoxy-2-phenylethyl]carbamoylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2R)-2-methoxy-2-phenylethyl]carbamoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 95145487 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | tert-butyl N-[2-[[(2R)-2-methoxy-2-phenylethyl]carbamoylamino]ethyl]carbamate |
| SMILES | CO[C@@H](CNC(=O)NCCNC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H27N3O4/c1-17(2,3)24-16(22)19-11-10-18-15(21)20-12-14(23-4)13-8-6-5-7-9-13/h5-9,14H,10-12H2,1-4H3,(H,19,22)(H2,18,20,21)/t14-/m0/s1 |
| InChIKey | KTOZBLRYSHOFHE-AWEZNQCLSA-N |
| XLogP | 2.20 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|