C18H30N2O3 — CID 109389686
1-(3-hydroxy-2,2,4-trimethylpentyl)-3-(2-methoxy-2-phenylethyl)urea (PubChem CID 109389686) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-(3-hydroxy-2,2,4-trimethylpentyl)-3-(2-methoxy-2-phenylethyl)urea.
| Compound Name | 1-(3-hydroxy-2,2,4-trimethylpentyl)-3-(2-methoxy-2-phenylethyl)urea |
|---|---|
| PubChem CID | 109389686 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 1-(3-hydroxy-2,2,4-trimethylpentyl)-3-(2-methoxy-2-phenylethyl)urea |
| SMILES | COC(CNC(=O)NCC(C)(C)C(O)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H30N2O3/c1-13(2)16(21)18(3,4)12-20-17(22)19-11-15(23-5)14-9-7-6-8-10-14/h6-10,13,15-16,21H,11-12H2,1-5H3,(H2,19,20,22) |
| InChIKey | NMHSSGKTFNYKKI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |