C18H26F3NO2 — CID 109380932
4,4,4-trifluoro-N-(3-hydroxy-2,2,4-trimethylpentyl)-3-phenylbutanamide (PubChem CID 109380932) has the molecular formula C18H26F3NO2 and a molecular weight of 345.41 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-(3-hydroxy-2,2,4-trimethylpentyl)-3-phenylbutanamide.
| Compound Name | 4,4,4-trifluoro-N-(3-hydroxy-2,2,4-trimethylpentyl)-3-phenylbutanamide |
|---|---|
| PubChem CID | 109380932 |
| Molecular Formula | C18H26F3NO2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 4,4,4-trifluoro-N-(3-hydroxy-2,2,4-trimethylpentyl)-3-phenylbutanamide |
| SMILES | CC(C)C(O)C(C)(C)CNC(=O)CC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H26F3NO2/c1-12(2)16(24)17(3,4)11-22-15(23)10-14(18(19,20)21)13-8-6-5-7-9-13/h5-9,12,14,16,24H,10-11H2,1-4H3,(H,22,23) |
| InChIKey | UAOJBQHHTRPOMB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |