C15H16F3NO3 — CID 146099713
methyl (E)-4-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]but-2-enoate (PubChem CID 146099713) has the molecular formula C15H16F3NO3 and a molecular weight of 315.29 g/mol. Its IUPAC name is methyl (E)-4-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]but-2-enoate.
| Compound Name | methyl (E)-4-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 146099713 |
| Molecular Formula | C15H16F3NO3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | methyl (E)-4-[(4,4,4-trifluoro-3-phenylbutanoyl)amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)CC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H16F3NO3/c1-22-14(21)8-5-9-19-13(20)10-12(15(16,17)18)11-6-3-2-4-7-11/h2-8,12H,9-10H2,1H3,(H,19,20)/b8-5+ |
| InChIKey | IWESAIHNZMBHCB-VMPITWQZSA-N |
| XLogP | 2.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|