C17H23NO4 — CID 146100035
methyl (E)-5-[(2-hydroxy-2-methyl-3-phenylbutanoyl)amino]pent-2-enoate (PubChem CID 146100035) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is methyl (E)-5-[(2-hydroxy-2-methyl-3-phenylbutanoyl)amino]pent-2-enoate.
| Compound Name | methyl (E)-5-[(2-hydroxy-2-methyl-3-phenylbutanoyl)amino]pent-2-enoate |
|---|---|
| PubChem CID | 146100035 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | methyl (E)-5-[(2-hydroxy-2-methyl-3-phenylbutanoyl)amino]pent-2-enoate |
| SMILES | COC(=O)/C=C/CCNC(=O)C(C)(O)C(C)c1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c1-13(14-9-5-4-6-10-14)17(2,21)16(20)18-12-8-7-11-15(19)22-3/h4-7,9-11,13,21H,8,12H2,1-3H3,(H,18,20)/b11-7+ |
| InChIKey | VFBOWMLWIVFJSD-YRNVUSSQSA-N |
| XLogP | 1.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|