C17H21NO2S — CID 124608254
(2R,3R)-2-hydroxy-2-methyl-3-phenyl-N-(2-thiophen-2-ylethyl)butanamide (PubChem CID 124608254) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is (2R,3R)-2-hydroxy-2-methyl-3-phenyl-N-(2-thiophen-2-ylethyl)butanamide.
| Compound Name | (2R,3R)-2-hydroxy-2-methyl-3-phenyl-N-(2-thiophen-2-ylethyl)butanamide |
|---|---|
| PubChem CID | 124608254 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (2R,3R)-2-hydroxy-2-methyl-3-phenyl-N-(2-thiophen-2-ylethyl)butanamide |
| SMILES | C[C@H](c1ccccc1)[C@@](C)(O)C(=O)NCCc1cccs1 |
| InChI | InChI=1S/C17H21NO2S/c1-13(14-7-4-3-5-8-14)17(2,20)16(19)18-11-10-15-9-6-12-21-15/h3-9,12-13,20H,10-11H2,1-2H3,(H,18,19)/t13-,17-/m1/s1 |
| InChIKey | ZYYJDIWNIUCUJP-CXAGYDPISA-N |
| XLogP | 2.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |