C14H24N2O2S — CID 111750360
2-[(2-hydroxy-2-methylpropyl)-methylamino]-N-(2-thiophen-2-ylethyl)propanamide (PubChem CID 111750360) has the molecular formula C14H24N2O2S and a molecular weight of 284.42 g/mol. Its IUPAC name is 2-[(2-hydroxy-2-methylpropyl)-methylamino]-N-(2-thiophen-2-ylethyl)propanamide.
| Compound Name | 2-[(2-hydroxy-2-methylpropyl)-methylamino]-N-(2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 111750360 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-[(2-hydroxy-2-methylpropyl)-methylamino]-N-(2-thiophen-2-ylethyl)propanamide |
| SMILES | CC(C(=O)NCCc1cccs1)N(C)CC(C)(C)O |
| InChI | InChI=1S/C14H24N2O2S/c1-11(16(4)10-14(2,3)18)13(17)15-8-7-12-6-5-9-19-12/h5-6,9,11,18H,7-8,10H2,1-4H3,(H,15,17) |
| InChIKey | AXQVCFSXORSMHS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |