C18H22FN3O2S — CID 9041710
(2S)-2-[[2-(3-fluoroanilino)-2-oxoethyl]-methylamino]-N-(2-thiophen-2-ylethyl)propanamide (PubChem CID 9041710) has the molecular formula C18H22FN3O2S and a molecular weight of 363.46 g/mol. Its IUPAC name is (2S)-2-[[2-(3-fluoroanilino)-2-oxoethyl]-methylamino]-N-(2-thiophen-2-ylethyl)propanamide.
| Compound Name | (2S)-2-[[2-(3-fluoroanilino)-2-oxoethyl]-methylamino]-N-(2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 9041710 |
| Molecular Formula | C18H22FN3O2S |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (2S)-2-[[2-(3-fluoroanilino)-2-oxoethyl]-methylamino]-N-(2-thiophen-2-ylethyl)propanamide |
| SMILES | C[C@@H](C(=O)NCCc1cccs1)N(C)CC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C18H22FN3O2S/c1-13(18(24)20-9-8-16-7-4-10-25-16)22(2)12-17(23)21-15-6-3-5-14(19)11-15/h3-7,10-11,13H,8-9,12H2,1-2H3,(H,20,24)(H,21,23)/t13-/m0/s1 |
| InChIKey | VRPKQPRWJHXMMZ-ZDUSSCGKSA-N |
| XLogP | 2.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |