C24H32O4Si — CID 10835513
methyl (E,6R)-7-[tert-butyl(diphenyl)silyl]oxy-6-hydroxyhept-2-enoate (PubChem CID 10835513) has the molecular formula C24H32O4Si and a molecular weight of 412.60 g/mol. Its IUPAC name is methyl (E,6R)-7-[tert-butyl(diphenyl)silyl]oxy-6-hydroxyhept-2-enoate.
| Compound Name | methyl (E,6R)-7-[tert-butyl(diphenyl)silyl]oxy-6-hydroxyhept-2-enoate |
|---|---|
| PubChem CID | 10835513 |
| Molecular Formula | C24H32O4Si |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | methyl (E,6R)-7-[tert-butyl(diphenyl)silyl]oxy-6-hydroxyhept-2-enoate |
| SMILES | COC(=O)/C=C/CC[C@@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H32O4Si/c1-24(2,3)29(21-14-7-5-8-15-21,22-16-9-6-10-17-22)28-19-20(25)13-11-12-18-23(26)27-4/h5-10,12,14-18,20,25H,11,13,19H2,1-4H3/b18-12+/t20-/m1/s1 |
| InChIKey | CELFGOLCGLYIHA-VOMPUTFMSA-N |
| XLogP | 3.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|