C23H31IO2Si — CID 155931189
(E,3S)-1-[tert-butyl(diphenyl)silyl]oxy-7-iodohept-6-en-3-ol (PubChem CID 155931189) has the molecular formula C23H31IO2Si and a molecular weight of 494.49 g/mol. Its IUPAC name is (E,3S)-1-[tert-butyl(diphenyl)silyl]oxy-7-iodohept-6-en-3-ol.
| Compound Name | (E,3S)-1-[tert-butyl(diphenyl)silyl]oxy-7-iodohept-6-en-3-ol |
|---|---|
| PubChem CID | 155931189 |
| Molecular Formula | C23H31IO2Si |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | (E,3S)-1-[tert-butyl(diphenyl)silyl]oxy-7-iodohept-6-en-3-ol |
| SMILES | CC(C)(C)[Si](OCC[C@@H](O)CC/C=C/I)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31IO2Si/c1-23(2,3)27(21-13-6-4-7-14-21,22-15-8-5-9-16-22)26-19-17-20(25)12-10-11-18-24/h4-9,11,13-16,18,20,25H,10,12,17,19H2,1-3H3/b18-11+/t20-/m0/s1 |
| InChIKey | DDNLFXQMOBNECV-OBXYEHHASA-N |
| XLogP | 5.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|