C21H30O3Si — CID 11142897
tert-butyl-(3,3-dimethoxypropoxy)-diphenylsilane (PubChem CID 11142897) has the molecular formula C21H30O3Si and a molecular weight of 358.55 g/mol. Its IUPAC name is tert-butyl-(3,3-dimethoxypropoxy)-diphenylsilane.
| Compound Name | tert-butyl-(3,3-dimethoxypropoxy)-diphenylsilane |
|---|---|
| PubChem CID | 11142897 |
| Molecular Formula | C21H30O3Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | tert-butyl-(3,3-dimethoxypropoxy)-diphenylsilane |
| SMILES | COC(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC |
| InChI | InChI=1S/C21H30O3Si/c1-21(2,3)25(18-12-8-6-9-13-18,19-14-10-7-11-15-19)24-17-16-20(22-4)23-5/h6-15,20H,16-17H2,1-5H3 |
| InChIKey | DYZCRFAMHAMIJQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|