C25H34O4Si — CID 24795141
(3R)-7-[tert-butyl(diphenyl)silyl]oxy-1,1-dimethoxyhept-4-yn-3-ol (PubChem CID 24795141) has the molecular formula C25H34O4Si and a molecular weight of 426.63 g/mol. Its IUPAC name is (3R)-7-[tert-butyl(diphenyl)silyl]oxy-1,1-dimethoxyhept-4-yn-3-ol.
| Compound Name | (3R)-7-[tert-butyl(diphenyl)silyl]oxy-1,1-dimethoxyhept-4-yn-3-ol |
|---|---|
| PubChem CID | 24795141 |
| Molecular Formula | C25H34O4Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (3R)-7-[tert-butyl(diphenyl)silyl]oxy-1,1-dimethoxyhept-4-yn-3-ol |
| SMILES | COC(C[C@@H](O)C#CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC |
| InChI | InChI=1S/C25H34O4Si/c1-25(2,3)30(22-15-8-6-9-16-22,23-17-10-7-11-18-23)29-19-13-12-14-21(26)20-24(27-4)28-5/h6-11,15-18,21,24,26H,13,19-20H2,1-5H3/t21-/m0/s1 |
| InChIKey | UZMRKQMQFHJHDT-NRFANRHFSA-N |
| XLogP | 3.33 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|