C34H38O2Si2 — CID 11082053
tert-butyl-[5-[methyl(diphenyl)silyl]oxypent-3-ynoxy]-diphenylsilane (PubChem CID 11082053) has the molecular formula C34H38O2Si2 and a molecular weight of 534.85 g/mol. Its IUPAC name is tert-butyl-[5-[methyl(diphenyl)silyl]oxypent-3-ynoxy]-diphenylsilane.
| Compound Name | tert-butyl-[5-[methyl(diphenyl)silyl]oxypent-3-ynoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11082053 |
| Molecular Formula | C34H38O2Si2 |
| Molecular Weight | 534.85 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | tert-butyl-[5-[methyl(diphenyl)silyl]oxypent-3-ynoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCC#CCO[Si](C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H38O2Si2/c1-34(2,3)38(32-24-14-7-15-25-32,33-26-16-8-17-27-33)36-29-19-9-18-28-35-37(4,30-20-10-5-11-21-30)31-22-12-6-13-23-31/h5-8,10-17,20-27H,19,28-29H2,1-4H3 |
| InChIKey | RWNPATZHTGNLRU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.85 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|