C23H30O2Si — CID 132916775
7-[tert-butyl(diphenyl)silyl]oxyhept-4-yn-1-ol (PubChem CID 132916775) has the molecular formula C23H30O2Si and a molecular weight of 366.58 g/mol. Its IUPAC name is 7-[tert-butyl(diphenyl)silyl]oxyhept-4-yn-1-ol.
| Compound Name | 7-[tert-butyl(diphenyl)silyl]oxyhept-4-yn-1-ol |
|---|---|
| PubChem CID | 132916775 |
| Molecular Formula | C23H30O2Si |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 7-[tert-butyl(diphenyl)silyl]oxyhept-4-yn-1-ol |
| SMILES | CC(C)(C)[Si](OCCC#CCCCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30O2Si/c1-23(2,3)26(21-15-9-7-10-16-21,22-17-11-8-12-18-22)25-20-14-6-4-5-13-19-24/h7-12,15-18,24H,5,13-14,19-20H2,1-3H3 |
| InChIKey | DFUJULQPIQNYSR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|