C22H34O4Si — CID 161331009
3-[tert-butyl(diphenyl)silyl]oxypropan-1-ol;propane-1,3-diol (PubChem CID 161331009) has the molecular formula C22H34O4Si and a molecular weight of 390.60 g/mol. Its IUPAC name is 3-[tert-butyl(diphenyl)silyl]oxypropan-1-ol;propane-1,3-diol.
| Compound Name | 3-[tert-butyl(diphenyl)silyl]oxypropan-1-ol;propane-1,3-diol |
|---|---|
| PubChem CID | 161331009 |
| Molecular Formula | C22H34O4Si |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 3-[tert-butyl(diphenyl)silyl]oxypropan-1-ol;propane-1,3-diol |
| SMILES | CC(C)(C)[Si](OCCCO)(c1ccccc1)c1ccccc1.OCCCO |
| InChI | InChI=1S/C19H26O2Si.C3H8O2/c1-19(2,3)22(21-16-10-15-20,17-11-6-4-7-12-17)18-13-8-5-9-14-18;4-2-1-3-5/h4-9,11-14,20H,10,15-16H2,1-3H3;4-5H,1-3H2 |
| InChIKey | VLKKULCYSUYIKQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|