C32H36O2Si — CID 165343479
4-[tert-butyl(diphenyl)silyl]oxy-1,1-diphenylbutan-1-ol (PubChem CID 165343479) has the molecular formula C32H36O2Si and a molecular weight of 480.72 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-1,1-diphenylbutan-1-ol.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-1,1-diphenylbutan-1-ol |
|---|---|
| PubChem CID | 165343479 |
| Molecular Formula | C32H36O2Si |
| Molecular Weight | 480.72 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-1,1-diphenylbutan-1-ol |
| SMILES | CC(C)(C)[Si](OCCCC(O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H36O2Si/c1-31(2,3)35(29-21-12-6-13-22-29,30-23-14-7-15-24-30)34-26-16-25-32(33,27-17-8-4-9-18-27)28-19-10-5-11-20-28/h4-15,17-24,33H,16,25-26H2,1-3H3 |
| InChIKey | ASDSTCXSTJGWIF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.72 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|