C43H50O2Si — CID 102242281
tert-butyl-diphenyl-(8-trityloxyoctoxy)silane (PubChem CID 102242281) has the molecular formula C43H50O2Si and a molecular weight of 626.96 g/mol. Its IUPAC name is tert-butyl-diphenyl-(8-trityloxyoctoxy)silane.
| Compound Name | tert-butyl-diphenyl-(8-trityloxyoctoxy)silane |
|---|---|
| PubChem CID | 102242281 |
| Molecular Formula | C43H50O2Si |
| Molecular Weight | 626.96 g/mol |
| Exact Mass | 626.36 |
| IUPAC Name | tert-butyl-diphenyl-(8-trityloxyoctoxy)silane |
| SMILES | CC(C)(C)[Si](OCCCCCCCCOC(c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H50O2Si/c1-42(2,3)46(40-31-19-11-20-32-40,41-33-21-12-22-34-41)45-36-24-7-5-4-6-23-35-44-43(37-25-13-8-14-26-37,38-27-15-9-16-28-38)39-29-17-10-18-30-39/h8-22,25-34H,4-7,23-24,35-36H2,1-3H3 |
| InChIKey | GYIWVDBTGKHQKC-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.96 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|