C31H42O2Si — CID 16753413
tert-butyl-dimethyl-(6-trityloxyhexoxy)silane (PubChem CID 16753413) has the molecular formula C31H42O2Si and a molecular weight of 474.76 g/mol. Its IUPAC name is tert-butyl-dimethyl-(6-trityloxyhexoxy)silane.
| Compound Name | tert-butyl-dimethyl-(6-trityloxyhexoxy)silane |
|---|---|
| PubChem CID | 16753413 |
| Molecular Formula | C31H42O2Si |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | tert-butyl-dimethyl-(6-trityloxyhexoxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H42O2Si/c1-30(2,3)34(4,5)33-26-18-7-6-17-25-32-31(27-19-11-8-12-20-27,28-21-13-9-14-22-28)29-23-15-10-16-24-29/h8-16,19-24H,6-7,17-18,25-26H2,1-5H3 |
| InChIKey | VSOYCQLYSDYGLR-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|