C30H42IOPSi — CID 140621382
6-[tert-butyl(dimethyl)silyl]oxyhexyl-iodo-triphenyl-λ5-phosphane (PubChem CID 140621382) has the molecular formula C30H42IOPSi and a molecular weight of 604.63 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxyhexyl-iodo-triphenyl-λ5-phosphane.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxyhexyl-iodo-triphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 140621382 |
| Molecular Formula | C30H42IOPSi |
| Molecular Weight | 604.63 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxyhexyl-iodo-triphenyl-λ5-phosphane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCP(I)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H42IOPSi/c1-30(2,3)34(4,5)32-25-17-6-7-18-26-33(31,27-19-11-8-12-20-27,28-21-13-9-14-22-28)29-23-15-10-16-24-29/h8-16,19-24H,6-7,17-18,25-26H2,1-5H3 |
| InChIKey | KSGVFYJYZWGQHW-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.63 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|