C21H37FOSi — CID 135068187
tert-butyl-[(7S)-7-fluoro-9-phenylnonoxy]-dimethylsilane (PubChem CID 135068187) has the molecular formula C21H37FOSi and a molecular weight of 352.61 g/mol. Its IUPAC name is tert-butyl-[(7S)-7-fluoro-9-phenylnonoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(7S)-7-fluoro-9-phenylnonoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135068187 |
| Molecular Formula | C21H37FOSi |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | tert-butyl-[(7S)-7-fluoro-9-phenylnonoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCC[C@H](F)CCc1ccccc1 |
| InChI | InChI=1S/C21H37FOSi/c1-21(2,3)24(4,5)23-18-12-7-6-11-15-20(22)17-16-19-13-9-8-10-14-19/h8-10,13-14,20H,6-7,11-12,15-18H2,1-5H3/t20-/m0/s1 |
| InChIKey | NHSMMGYYWPDDPX-FQEVSTJZSA-N |
| XLogP | 6.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|