C18H33NOSi — CID 11709316
N-benzyl-5-[tert-butyl(dimethyl)silyl]oxypentan-1-amine (PubChem CID 11709316) has the molecular formula C18H33NOSi and a molecular weight of 307.55 g/mol. Its IUPAC name is N-benzyl-5-[tert-butyl(dimethyl)silyl]oxypentan-1-amine.
| Compound Name | N-benzyl-5-[tert-butyl(dimethyl)silyl]oxypentan-1-amine |
|---|---|
| PubChem CID | 11709316 |
| Molecular Formula | C18H33NOSi |
| Molecular Weight | 307.55 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | N-benzyl-5-[tert-butyl(dimethyl)silyl]oxypentan-1-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCNCc1ccccc1 |
| InChI | InChI=1S/C18H33NOSi/c1-18(2,3)21(4,5)20-15-11-7-10-14-19-16-17-12-8-6-9-13-17/h6,8-9,12-13,19H,7,10-11,14-16H2,1-5H3 |
| InChIKey | RAQDPZARIHBTPE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|