C15H26F5NOSSi — CID 174011188
2-[tert-butyl(dimethyl)silyl]oxy-N-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methyl]ethanamine (PubChem CID 174011188) has the molecular formula C15H26F5NOSSi and a molecular weight of 391.52 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-N-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methyl]ethanamine.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-N-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 174011188 |
| Molecular Formula | C15H26F5NOSSi |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-N-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methyl]ethanamine |
| SMILES | CC(C)(C)[Si](C)(C)OCCNCc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C15H26F5NOSSi/c1-15(2,3)24(4,5)22-11-10-21-12-13-6-8-14(9-7-13)23(16,17,18,19)20/h6-9,21H,10-12H2,1-5H3 |
| InChIKey | KEOAGUGMPULZFM-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|