C14H23NO2Si — CID 142526581
5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2-carbaldehyde (PubChem CID 142526581) has the molecular formula C14H23NO2Si and a molecular weight of 265.43 g/mol. Its IUPAC name is 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2-carbaldehyde.
| Compound Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 142526581 |
| Molecular Formula | C14H23NO2Si |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1ccc(C=O)nc1 |
| InChI | InChI=1S/C14H23NO2Si/c1-14(2,3)18(4,5)17-9-8-12-6-7-13(11-16)15-10-12/h6-7,10-11H,8-9H2,1-5H3 |
| InChIKey | IGTKXMHFBSDKQA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|