C15H25NO2Si — CID 158302503
3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-methylpyridine-2-carbaldehyde (PubChem CID 158302503) has the molecular formula C15H25NO2Si and a molecular weight of 279.46 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-methylpyridine-2-carbaldehyde.
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-methylpyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 158302503 |
| Molecular Formula | C15H25NO2Si |
| Molecular Weight | 279.46 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-methylpyridine-2-carbaldehyde |
| SMILES | Cc1ccc(CCO[Si](C)(C)C(C)(C)C)c(C=O)n1 |
| InChI | InChI=1S/C15H25NO2Si/c1-12-7-8-13(14(11-17)16-12)9-10-18-19(5,6)15(2,3)4/h7-8,11H,9-10H2,1-6H3 |
| InChIKey | NCZBSWGADJMKFO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|