C14H24O2SSi — CID 131735364
5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]thiophene-2-carbaldehyde (PubChem CID 131735364) has the molecular formula C14H24O2SSi and a molecular weight of 284.50 g/mol. Its IUPAC name is 5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]thiophene-2-carbaldehyde.
| Compound Name | 5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 131735364 |
| Molecular Formula | C14H24O2SSi |
| Molecular Weight | 284.50 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]thiophene-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCCCc1ccc(C=O)s1 |
| InChI | InChI=1S/C14H24O2SSi/c1-14(2,3)18(4,5)16-10-6-7-12-8-9-13(11-15)17-12/h8-9,11H,6-7,10H2,1-5H3 |
| InChIKey | YAWAXSYKMHRLDK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|