C13H22O3SSi — CID 18629051
5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]thiophene-2-carboxylic acid (PubChem CID 18629051) has the molecular formula C13H22O3SSi and a molecular weight of 286.47 g/mol. Its IUPAC name is 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 18629051 |
| Molecular Formula | C13H22O3SSi |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]thiophene-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C13H22O3SSi/c1-13(2,3)18(4,5)16-9-8-10-6-7-11(17-10)12(14)15/h6-7H,8-9H2,1-5H3,(H,14,15) |
| InChIKey | AMLPDCLPCFGGJZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|