C18H30O3Si — CID 175203615
2-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]benzaldehyde (PubChem CID 175203615) has the molecular formula C18H30O3Si and a molecular weight of 322.52 g/mol. Its IUPAC name is 2-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]benzaldehyde.
| Compound Name | 2-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]benzaldehyde |
|---|---|
| PubChem CID | 175203615 |
| Molecular Formula | C18H30O3Si |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 2-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]benzaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCOc1ccccc1C=O |
| InChI | InChI=1S/C18H30O3Si/c1-18(2,3)22(4,5)21-14-10-6-9-13-20-17-12-8-7-11-16(17)15-19/h7-8,11-12,15H,6,9-10,13-14H2,1-5H3 |
| InChIKey | RIUFBXZQMUGBHH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|