C16H23NO3Si — CID 166136317
3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-formylbenzonitrile (PubChem CID 166136317) has the molecular formula C16H23NO3Si and a molecular weight of 305.45 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-formylbenzonitrile.
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-formylbenzonitrile |
|---|---|
| PubChem CID | 166136317 |
| Molecular Formula | C16H23NO3Si |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-formylbenzonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCCOc1cc(C#N)ccc1C=O |
| InChI | InChI=1S/C16H23NO3Si/c1-16(2,3)21(4,5)20-9-8-19-15-10-13(11-17)6-7-14(15)12-18/h6-7,10,12H,8-9H2,1-5H3 |
| InChIKey | UFWZHKHTQRECBZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|