C22H32N2O3Si — CID 58083069
3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4,6-dimethylpyrimidin-5-yl]-2-methylbenzaldehyde (PubChem CID 58083069) has the molecular formula C22H32N2O3Si and a molecular weight of 400.60 g/mol. Its IUPAC name is 3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4,6-dimethylpyrimidin-5-yl]-2-methylbenzaldehyde.
| Compound Name | 3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4,6-dimethylpyrimidin-5-yl]-2-methylbenzaldehyde |
|---|---|
| PubChem CID | 58083069 |
| Molecular Formula | C22H32N2O3Si |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4,6-dimethylpyrimidin-5-yl]-2-methylbenzaldehyde |
| SMILES | Cc1nc(OCCO[Si](C)(C)C(C)(C)C)nc(C)c1-c1cccc(C=O)c1C |
| InChI | InChI=1S/C22H32N2O3Si/c1-15-18(14-25)10-9-11-19(15)20-16(2)23-21(24-17(20)3)26-12-13-27-28(7,8)22(4,5)6/h9-11,14H,12-13H2,1-8H3 |
| InChIKey | YVVYUTJYXLGGSH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|