C31H40O4Si — CID 59544366
4-[[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2,5-dimethylphenyl]-2-methylphenyl]methoxy]benzaldehyde (PubChem CID 59544366) has the molecular formula C31H40O4Si and a molecular weight of 504.74 g/mol. Its IUPAC name is 4-[[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2,5-dimethylphenyl]-2-methylphenyl]methoxy]benzaldehyde.
| Compound Name | 4-[[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2,5-dimethylphenyl]-2-methylphenyl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 59544366 |
| Molecular Formula | C31H40O4Si |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 4-[[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2,5-dimethylphenyl]-2-methylphenyl]methoxy]benzaldehyde |
| SMILES | Cc1cc(-c2cccc(COc3ccc(C=O)cc3)c2C)c(C)cc1OCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H40O4Si/c1-22-19-30(33-16-17-35-36(7,8)31(4,5)6)23(2)18-29(22)28-11-9-10-26(24(28)3)21-34-27-14-12-25(20-32)13-15-27/h9-15,18-20H,16-17,21H2,1-8H3 |
| InChIKey | CWXRTJKTTWUSTH-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|