C24H25INO4P — CID 143796678
4-[[3-[6-(2-iodophosphanyloxyethoxy)-2,4-dimethyl-3-pyridinyl]-2-methylphenyl]methoxy]benzaldehyde (PubChem CID 143796678) has the molecular formula C24H25INO4P and a molecular weight of 549.35 g/mol. Its IUPAC name is 4-[[3-[6-(2-iodophosphanyloxyethoxy)-2,4-dimethyl-3-pyridinyl]-2-methylphenyl]methoxy]benzaldehyde.
| Compound Name | 4-[[3-[6-(2-iodophosphanyloxyethoxy)-2,4-dimethyl-3-pyridinyl]-2-methylphenyl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 143796678 |
| Molecular Formula | C24H25INO4P |
| Molecular Weight | 549.35 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | 4-[[3-[6-(2-iodophosphanyloxyethoxy)-2,4-dimethyl-3-pyridinyl]-2-methylphenyl]methoxy]benzaldehyde |
| SMILES | Cc1cc(OCCOPI)nc(C)c1-c1cccc(COc2ccc(C=O)cc2)c1C |
| InChI | InChI=1S/C24H25INO4P/c1-16-13-23(28-11-12-30-31-25)26-18(3)24(16)22-6-4-5-20(17(22)2)15-29-21-9-7-19(14-27)8-10-21/h4-10,13-14,31H,11-12,15H2,1-3H3 |
| InChIKey | WDHFKYRTZBUQML-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.35 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|