C27H26IN2O5PS — CID 143796630
(5Z)-5-[[4-[[3-[6-(2-iodophosphanyloxyethoxy)-2,4-dimethyl-3-pyridinyl]-2-methylphenyl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 143796630) has the molecular formula C27H26IN2O5PS and a molecular weight of 648.46 g/mol. Its IUPAC name is (5Z)-5-[[4-[[3-[6-(2-iodophosphanyloxyethoxy)-2,4-dimethyl-3-pyridinyl]-2-methylphenyl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[[3-[6-(2-iodophosphanyloxyethoxy)-2,4-dimethyl-3-pyridinyl]-2-methylphenyl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 143796630 |
| Molecular Formula | C27H26IN2O5PS |
| Molecular Weight | 648.46 g/mol |
| Exact Mass | 648.03 |
| IUPAC Name | (5Z)-5-[[4-[[3-[6-(2-iodophosphanyloxyethoxy)-2,4-dimethyl-3-pyridinyl]-2-methylphenyl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(OCCOPI)nc(C)c1-c1cccc(COc2ccc(/C=C3\SC(=O)NC3=O)cc2)c1C |
| InChI | InChI=1S/C27H26IN2O5PS/c1-16-13-24(33-11-12-35-36-28)29-18(3)25(16)22-6-4-5-20(17(22)2)15-34-21-9-7-19(8-10-21)14-23-26(31)30-27(32)37-23/h4-10,13-14,36H,11-12,15H2,1-3H3,(H,30,31,32)/b23-14- |
| InChIKey | JUBBLFIQROBHOL-UCQKPKSFSA-N |
| XLogP | 6.92 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.46 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|