C19H17NO4S — CID 16634004
(5Z)-5-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 16634004) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is (5Z)-5-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 16634004 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (5Z)-5-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2\SC(=O)NC2=O)ccc1OCc1ccccc1C |
| InChI | InChI=1S/C19H17NO4S/c1-12-5-3-4-6-14(12)11-24-15-8-7-13(9-16(15)23-2)10-17-18(21)20-19(22)25-17/h3-10H,11H2,1-2H3,(H,20,21,22)/b17-10- |
| InChIKey | GDVGNAOPZWKWKF-YVLHZVERSA-N |
| XLogP | 3.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|