C21H21NO5S — CID 2277908
(5E)-5-[[4-[2-(3,5-dimethylphenoxy)ethoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 2277908) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is (5E)-5-[[4-[2-(3,5-dimethylphenoxy)ethoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[2-(3,5-dimethylphenoxy)ethoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2277908 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (5E)-5-[[4-[2-(3,5-dimethylphenoxy)ethoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/SC(=O)NC2=O)ccc1OCCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C21H21NO5S/c1-13-8-14(2)10-16(9-13)26-6-7-27-17-5-4-15(11-18(17)25-3)12-19-20(23)22-21(24)28-19/h4-5,8-12H,6-7H2,1-3H3,(H,22,23,24)/b19-12+ |
| InChIKey | JXHXFVNMEMRBCY-XDHOZWIPSA-N |
| XLogP | 4.09 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|