C30H27NO8S — CID 143796673
2-[3-(acetyloxymethyl)-4-[3-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]phenyl]phenoxy]ethyl acetate (PubChem CID 143796673) has the molecular formula C30H27NO8S and a molecular weight of 561.61 g/mol. Its IUPAC name is 2-[3-(acetyloxymethyl)-4-[3-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]phenyl]phenoxy]ethyl acetate.
| Compound Name | 2-[3-(acetyloxymethyl)-4-[3-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]phenyl]phenoxy]ethyl acetate |
|---|---|
| PubChem CID | 143796673 |
| Molecular Formula | C30H27NO8S |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 2-[3-(acetyloxymethyl)-4-[3-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]phenyl]phenoxy]ethyl acetate |
| SMILES | CC(=O)OCCOc1ccc(-c2cccc(COc3ccc(/C=C4\SC(=O)NC4=O)cc3)c2)c(COC(C)=O)c1 |
| InChI | InChI=1S/C30H27NO8S/c1-19(32)36-12-13-37-26-10-11-27(24(16-26)18-38-20(2)33)23-5-3-4-22(14-23)17-39-25-8-6-21(7-9-25)15-28-29(34)31-30(35)40-28/h3-11,14-16H,12-13,17-18H2,1-2H3,(H,31,34,35)/b28-15- |
| InChIKey | FHTURNFYSHEUIV-MBTHVWNTSA-N |
| XLogP | 5.26 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|