C25H28N2O4S — CID 90726055
[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]methyl N-tert-butyl-N-propylcarbamate (PubChem CID 90726055) has the molecular formula C25H28N2O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is [3-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]methyl N-tert-butyl-N-propylcarbamate.
| Compound Name | [3-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]methyl N-tert-butyl-N-propylcarbamate |
|---|---|
| PubChem CID | 90726055 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [3-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]methyl N-tert-butyl-N-propylcarbamate |
| SMILES | CCCN(C(=O)OCc1cccc(-c2ccc(C=C3SC(=O)NC3=O)cc2)c1)C(C)(C)C |
| InChI | InChI=1S/C25H28N2O4S/c1-5-13-27(25(2,3)4)24(30)31-16-18-7-6-8-20(14-18)19-11-9-17(10-12-19)15-21-22(28)26-23(29)32-21/h6-12,14-15H,5,13,16H2,1-4H3,(H,26,28,29) |
| InChIKey | LAOPWZUEAHGADV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|