C29H28N2O5S — CID 86591260
N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]methyl]-3,4-diethoxy-N-methylbenzamide (PubChem CID 86591260) has the molecular formula C29H28N2O5S and a molecular weight of 516.62 g/mol. Its IUPAC name is N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]methyl]-3,4-diethoxy-N-methylbenzamide.
| Compound Name | N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]methyl]-3,4-diethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 86591260 |
| Molecular Formula | C29H28N2O5S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]methyl]-3,4-diethoxy-N-methylbenzamide |
| SMILES | CCOc1ccc(C(=O)N(C)Cc2cccc(-c3ccc(C=C4SC(=O)NC4=O)cc3)c2)cc1OCC |
| InChI | InChI=1S/C29H28N2O5S/c1-4-35-24-14-13-23(17-25(24)36-5-2)28(33)31(3)18-20-7-6-8-22(15-20)21-11-9-19(10-12-21)16-26-27(32)30-29(34)37-26/h6-17H,4-5,18H2,1-3H3,(H,30,32,34) |
| InChIKey | NAFJLDZXOZFYJW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|