C18H20FNO2 — CID 86937954
4-ethoxy-N-[(3-fluorophenyl)methyl]-N,3-dimethylbenzamide (PubChem CID 86937954) has the molecular formula C18H20FNO2 and a molecular weight of 301.36 g/mol. Its IUPAC name is 4-ethoxy-N-[(3-fluorophenyl)methyl]-N,3-dimethylbenzamide.
| Compound Name | 4-ethoxy-N-[(3-fluorophenyl)methyl]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 86937954 |
| Molecular Formula | C18H20FNO2 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-ethoxy-N-[(3-fluorophenyl)methyl]-N,3-dimethylbenzamide |
| SMILES | CCOc1ccc(C(=O)N(C)Cc2cccc(F)c2)cc1C |
| InChI | InChI=1S/C18H20FNO2/c1-4-22-17-9-8-15(10-13(17)2)18(21)20(3)12-14-6-5-7-16(19)11-14/h5-11H,4,12H2,1-3H3 |
| InChIKey | DPTQOZSYELNHLE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |