C36H36N2O8S2 — CID 142633467
5-[[4-[5-[4-[5-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]pentoxy]phenoxy]pentoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 142633467) has the molecular formula C36H36N2O8S2 and a molecular weight of 688.82 g/mol. Its IUPAC name is 5-[[4-[5-[4-[5-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]pentoxy]phenoxy]pentoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[5-[4-[5-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]pentoxy]phenoxy]pentoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 142633467 |
| Molecular Formula | C36H36N2O8S2 |
| Molecular Weight | 688.82 g/mol |
| Exact Mass | 688.19 |
| IUPAC Name | 5-[[4-[5-[4-[5-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]pentoxy]phenoxy]pentoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(OCCCCCOc3ccc(OCCCCCOc4ccc(C=C5SC(=O)NC5=O)cc4)cc3)cc2)S1 |
| InChI | InChI=1S/C36H36N2O8S2/c39-33-31(47-35(41)37-33)23-25-7-11-27(12-8-25)43-19-3-1-5-21-45-29-15-17-30(18-16-29)46-22-6-2-4-20-44-28-13-9-26(10-14-28)24-32-34(40)38-36(42)48-32/h7-18,23-24H,1-6,19-22H2,(H,37,39,41)(H,38,40,42) |
| InChIKey | AXXTVGMKCPURLM-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.82 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|