C25H29NO5S — CID 57489745
11-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl]oxyundecanoic acid (PubChem CID 57489745) has the molecular formula C25H29NO5S and a molecular weight of 455.58 g/mol. Its IUPAC name is 11-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl]oxyundecanoic acid.
| Compound Name | 11-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl]oxyundecanoic acid |
|---|---|
| PubChem CID | 57489745 |
| Molecular Formula | C25H29NO5S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 11-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl]oxyundecanoic acid |
| SMILES | O=C(O)CCCCCCCCCCOc1ccc2cc(/C=C3/SC(=O)NC3=O)ccc2c1 |
| InChI | InChI=1S/C25H29NO5S/c27-23(28)9-7-5-3-1-2-4-6-8-14-31-21-13-12-19-15-18(10-11-20(19)17-21)16-22-24(29)26-25(30)32-22/h10-13,15-17H,1-9,14H2,(H,27,28)(H,26,29,30)/b22-16+ |
| InChIKey | NDUMGRUKHBJNDS-CJLVFECKSA-N |
| XLogP | 6.14 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|