C19H17NO5S — CID 87217229
5-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-1-yl]oxypentanoic acid (PubChem CID 87217229) has the molecular formula C19H17NO5S and a molecular weight of 371.41 g/mol. Its IUPAC name is 5-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-1-yl]oxypentanoic acid.
| Compound Name | 5-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-1-yl]oxypentanoic acid |
|---|---|
| PubChem CID | 87217229 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 5-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-1-yl]oxypentanoic acid |
| SMILES | O=C(O)CCCCOc1ccc(/C=C2/SC(=O)NC2=O)c2ccccc12 |
| InChI | InChI=1S/C19H17NO5S/c21-17(22)7-3-4-10-25-15-9-8-12(13-5-1-2-6-14(13)15)11-16-18(23)20-19(24)26-16/h1-2,5-6,8-9,11H,3-4,7,10H2,(H,21,22)(H,20,23,24)/b16-11+ |
| InChIKey | RDKMUVWAEHLOBD-LFIBNONCSA-N |
| XLogP | 3.80 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|