C22H25NO5S — CID 142938483
8-[4-[(Z)-(4-hydroxy-2-oxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-1-yl]oxyoctanoic acid (PubChem CID 142938483) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is 8-[4-[(Z)-(4-hydroxy-2-oxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-1-yl]oxyoctanoic acid.
| Compound Name | 8-[4-[(Z)-(4-hydroxy-2-oxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-1-yl]oxyoctanoic acid |
|---|---|
| PubChem CID | 142938483 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 8-[4-[(Z)-(4-hydroxy-2-oxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-1-yl]oxyoctanoic acid |
| SMILES | O=C(O)CCCCCCCOc1ccc(/C=C2\SC(=O)NC2O)c2ccccc12 |
| InChI | InChI=1S/C22H25NO5S/c24-20(25)10-4-2-1-3-7-13-28-18-12-11-15(16-8-5-6-9-17(16)18)14-19-21(26)23-22(27)29-19/h5-6,8-9,11-12,14,21,26H,1-4,7,10,13H2,(H,23,27)(H,24,25)/b19-14- |
| InChIKey | WKEPOQJEONPYAG-RGEXLXHISA-N |
| XLogP | 4.76 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|