C14H13ClO3 — CID 43351513
4-(4-chloronaphthalen-1-yl)oxybutanoic acid (PubChem CID 43351513) has the molecular formula C14H13ClO3 and a molecular weight of 264.71 g/mol. Its IUPAC name is 4-(4-chloronaphthalen-1-yl)oxybutanoic acid.
| Compound Name | 4-(4-chloronaphthalen-1-yl)oxybutanoic acid |
|---|---|
| PubChem CID | 43351513 |
| Molecular Formula | C14H13ClO3 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 4-(4-chloronaphthalen-1-yl)oxybutanoic acid |
| SMILES | O=C(O)CCCOc1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C14H13ClO3/c15-12-7-8-13(18-9-3-6-14(16)17)11-5-2-1-4-10(11)12/h1-2,4-5,7-8H,3,6,9H2,(H,16,17) |
| InChIKey | RSDGOSUZHPLRKH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|