C15H15ClO3 — CID 55047842
4-(4-chloronaphthalen-1-yl)oxypentanoic acid (PubChem CID 55047842) has the molecular formula C15H15ClO3 and a molecular weight of 278.74 g/mol. Its IUPAC name is 4-(4-chloronaphthalen-1-yl)oxypentanoic acid.
| Compound Name | 4-(4-chloronaphthalen-1-yl)oxypentanoic acid |
|---|---|
| PubChem CID | 55047842 |
| Molecular Formula | C15H15ClO3 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 4-(4-chloronaphthalen-1-yl)oxypentanoic acid |
| SMILES | CC(CCC(=O)O)Oc1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C15H15ClO3/c1-10(6-9-15(17)18)19-14-8-7-13(16)11-4-2-3-5-12(11)14/h2-5,7-8,10H,6,9H2,1H3,(H,17,18) |
| InChIKey | KIQCYMNMRPNKND-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |