C15H15ClO2 — CID 113306220
4-(4-chloronaphthalen-1-yl)pentanoic acid (PubChem CID 113306220) has the molecular formula C15H15ClO2 and a molecular weight of 262.74 g/mol. Its IUPAC name is 4-(4-chloronaphthalen-1-yl)pentanoic acid.
| Compound Name | 4-(4-chloronaphthalen-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 113306220 |
| Molecular Formula | C15H15ClO2 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4-(4-chloronaphthalen-1-yl)pentanoic acid |
| SMILES | CC(CCC(=O)O)c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C15H15ClO2/c1-10(6-9-15(17)18)11-7-8-14(16)13-5-3-2-4-12(11)13/h2-5,7-8,10H,6,9H2,1H3,(H,17,18) |
| InChIKey | UCERKBCUTGGXPX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |