C19H19NO5S — CID 90849167
5-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]naphthalen-1-yl]oxypentanoic acid (PubChem CID 90849167) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is 5-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]naphthalen-1-yl]oxypentanoic acid.
| Compound Name | 5-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]naphthalen-1-yl]oxypentanoic acid |
|---|---|
| PubChem CID | 90849167 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 5-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]naphthalen-1-yl]oxypentanoic acid |
| SMILES | O=C(O)CCCCOc1ccc(Cc2sc(=O)[nH]c2O)c2ccccc12 |
| InChI | InChI=1S/C19H19NO5S/c21-17(22)7-3-4-10-25-15-9-8-12(13-5-1-2-6-14(13)15)11-16-18(23)20-19(24)26-16/h1-2,5-6,8-9,23H,3-4,7,10-11H2,(H,20,24)(H,21,22) |
| InChIKey | RAVGTXXYKWSAGV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|